CAS 188797-79-7 appears in our catalog under these names: Lurasidone Impurity 21, 6-Chloro-1,3-dihydro-5-(2-(1-piperazinyl)ethyl)-2H-Indol-2-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one (CAS 188797-79-7) is a chemical compound with the molecular formula C14H18ClN3O and a molecular weight of 279.76 g/mol. IUPAC name: 6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one. InChIKey: LLNIWWGUWKFGLE-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | 6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one |
| InChIKey | LLNIWWGUWKFGLE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CCC2=C(C=C3C(=C2)CC(=O)N3)Cl |
Computed by PubChem (NCBI)