CAS 123980-54-1 is the registry number for 8-Bromo-7-isobutyl-3-methyl-1H-purine-2,6(3H,7H)-dione. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
8-bromo-3-methyl-7-(2-methylpropyl)purine-2,6-dione (CAS 123980-54-1) is a chemical compound with the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. IUPAC name: 8-bromo-3-methyl-7-(2-methylpropyl)purine-2,6-dione. InChIKey: XPSDNVXPDLKEBY-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN4O2 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 8-bromo-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
| InChIKey | XPSDNVXPDLKEBY-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C2=C(N=C1Br)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)