CAS 368840-60-2 is the registry number for 8-Bromo-7-isopropyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
8-bromo-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione (CAS 368840-60-2) is a chemical compound with the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. IUPAC name: 8-bromo-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione. InChIKey: OYOSTJSOFBEGON-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN4O2 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 8-bromo-1,3-dimethyl-7-propan-2-ylpurine-2,6-dione |
| InChIKey | OYOSTJSOFBEGON-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(N=C1Br)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)