Products 1239843-07-2
CAS 1239843-07-2 is the registry number for 3-[3-(3-Fluoro-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[3-(3-fluoro-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 1239843-07-2) is a chemical compound with the molecular formula C12H11FN2O4 and a molecular weight of 266.22 g/mol. IUPAC name: 3-[3-(3-fluoro-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: OLGYAFFCZMDYIA-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O4 |
|---|---|
| Molecular weight | 266.22 g/mol |
| IUPAC name | 3-[3-(3-fluoro-4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | OLGYAFFCZMDYIA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NOC(=N2)CCC(=O)O)F |
Computed by PubChem (NCBI)