Products 2858742-34-2
CAS 2858742-34-2 is the registry number for Methyl 3-(2,4-dioxotetrahydropyrimidin-1(2H)-yl)-4-fluorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoate (CAS 2858742-34-2) is a chemical compound with the molecular formula C12H11FN2O4 and a molecular weight of 266.22 g/mol. IUPAC name: methyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoate. InChIKey: VSHRXCYVJVAJMR-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O4 |
|---|---|
| Molecular weight | 266.22 g/mol |
| IUPAC name | methyl 3-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoate |
| InChIKey | VSHRXCYVJVAJMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)N2CCC(=O)NC2=O |
Computed by PubChem (NCBI)