Products 124020-27-5
CAS 124020-27-5 appears in our catalog under these names: Levosulpiride-d3, S-(-)-Sulpiride-d3, S-(-)-Sulpiride-d3, >95% (HPLC), Levosulpiride-d3, 99.79%. Offered by: Chemat Brand, TRC, TargetMol, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 1mg, 5mg, 10mg, 5 mg, 1 mg.
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-sulfamoyl-2-(trideuteriomethoxy)benzamide (CAS 124020-27-5) is a chemical compound with the molecular formula C15H23N3O4S and a molecular weight of 344.4 g/mol. IUPAC name: N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-sulfamoyl-2-(trideuteriomethoxy)benzamide. InChIKey: BGRJTUBHPOOWDU-XTRIYBSESA-N.
| Molecular formula | C15H23N3O4S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-sulfamoyl-2-(trideuteriomethoxy)benzamide |
| InChIKey | BGRJTUBHPOOWDU-XTRIYBSESA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)S(=O)(=O)N)C(=O)NC[C@@H]2CCCN2CC |
Computed by PubChem (NCBI)