Products 93839-82-8
CAS 93839-82-8 is the registry number for 4-Amino-5-(ethylsulfonyl)-2-methoxy-N-(2-pyrrolidinylmethyl)benzamide. Offered by: TRC. Available pack sizes: 250mg.
4-amino-5-ethylsulfonyl-2-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide (CAS 93839-82-8) is a chemical compound with the molecular formula C15H23N3O4S and a molecular weight of 341.4 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide. InChIKey: BEDJAYJKACGEHH-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O4S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxy-N-(pyrrolidin-2-ylmethyl)benzamide |
| InChIKey | BEDJAYJKACGEHH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)NCC2CCCN2)OC)N |
Computed by PubChem (NCBI)