CAS 1240238-30-5 is the registry number for 1-((3,5-Dimethyl-1h-pyrazol-4-yl)sulfonyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazine;hydrochloride (CAS 1240238-30-5) is a chemical compound with the molecular formula C9H17ClN4O2S and a molecular weight of 280.78 g/mol. IUPAC name: 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazine;hydrochloride. InChIKey: BFSFOABWLLZBAU-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN4O2S |
|---|---|
| Molecular weight | 280.78 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazine;hydrochloride |
| InChIKey | BFSFOABWLLZBAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)N2CCNCC2.Cl |
Computed by PubChem (NCBI)