CAS 1828376-96-0 is the registry number for 1-((3,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)pyrrolidin-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride (CAS 1828376-96-0) is a chemical compound with the molecular formula C9H17ClN4O2S and a molecular weight of 280.78 g/mol. IUPAC name: 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride. InChIKey: NNXSUEJUXRMGSU-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN4O2S |
|---|---|
| Molecular weight | 280.78 g/mol |
| IUPAC name | 1-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]pyrrolidin-3-amine;hydrochloride |
| InChIKey | NNXSUEJUXRMGSU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)N2CCC(C2)N.Cl |
Computed by PubChem (NCBI)