CAS 1240250-29-6 is the registry number for Lithium piperidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium piperidine-2-carboxylate (CAS 1240250-29-6) is a chemical compound with the molecular formula C6H10LiNO2 and a molecular weight of 135.1 g/mol. IUPAC name: lithium piperidine-2-carboxylate. InChIKey: DFQQYEOCHCHLMA-UHFFFAOYSA-M.
| Molecular formula | C6H10LiNO2 |
|---|---|
| Molecular weight | 135.1 g/mol |
| IUPAC name | lithium piperidine-2-carboxylate |
| InChIKey | DFQQYEOCHCHLMA-UHFFFAOYSA-M |
| SMILES | [Li+].C1CCNC(C1)C(=O)[O-] |
Computed by PubChem (NCBI)