CAS 2102410-37-5 is the registry number for Lithium 3-(azetidin-1-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
Lithium 3-(azetidin-1-yl)propanoate (CAS 2102410-37-5) is a chemical compound with the molecular formula C6H10LiNO2 and a molecular weight of 135.1 g/mol. IUPAC name: lithium 3-(azetidin-1-yl)propanoate. InChIKey: SLAPOUVWEDACGE-UHFFFAOYSA-M.
| Molecular formula | C6H10LiNO2 |
|---|---|
| Molecular weight | 135.1 g/mol |
| IUPAC name | lithium 3-(azetidin-1-yl)propanoate |
| InChIKey | SLAPOUVWEDACGE-UHFFFAOYSA-M |
| SMILES | [Li+].C1CN(C1)CCC(=O)[O-] |
Computed by PubChem (NCBI)