Products 1240256-85-2

CAS 1240256-85-2 is the registry number for 2-Fluoro-4-(pentafluorosulfur)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-4-(pentafluoro-lambda6-sulfanyl)benzoyl chloride (CAS 1240256-85-2) is a chemical compound with the molecular formula C7H3ClF6OS and a molecular weight of 284.61 g/mol. IUPAC name: 2-fluoro-4-(pentafluoro-lambda6-sulfanyl)benzoyl chloride. InChIKey: ZJOFYWIDVCEMTP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF6OS
Molecular weight284.61 g/mol
IUPAC name2-fluoro-4-(pentafluoro-lambda6-sulfanyl)benzoyl chloride
InChIKeyZJOFYWIDVCEMTP-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(F)(F)(F)(F)F)F)C(=O)Cl

Computed by PubChem (NCBI)