CAS 1240256-92-1 is the registry number for 3-Fluoro-5-(pentafluorosulfur)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-fluoro-5-(pentafluoro-lambda6-sulfanyl)benzoyl chloride (CAS 1240256-92-1) is a chemical compound with the molecular formula C7H3ClF6OS and a molecular weight of 284.61 g/mol. IUPAC name: 3-fluoro-5-(pentafluoro-lambda6-sulfanyl)benzoyl chloride. InChIKey: RCKDILSECAWCTQ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF6OS |
|---|---|
| Molecular weight | 284.61 g/mol |
| IUPAC name | 3-fluoro-5-(pentafluoro-lambda6-sulfanyl)benzoyl chloride |
| InChIKey | RCKDILSECAWCTQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(F)(F)(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)