CAS 1240257-92-4 is the registry number for 3-Fluoro-5-(pentafluorosulfur)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-fluoro-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde (CAS 1240257-92-4) is a chemical compound with the molecular formula C7H4F6OS and a molecular weight of 250.16 g/mol. IUPAC name: 3-fluoro-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde. InChIKey: DBZCRWYMVZMAQC-UHFFFAOYSA-N.
| Molecular formula | C7H4F6OS |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | 3-fluoro-5-(pentafluoro-lambda6-sulfanyl)benzaldehyde |
| InChIKey | DBZCRWYMVZMAQC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(F)(F)(F)(F)F)C=O |
Computed by PubChem (NCBI)