CAS 3817-20-7 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-(thiophen-2-yl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,3,3,3-hexafluoro-2-thiophen-2-ylpropan-2-ol (CAS 3817-20-7) is a chemical compound with the molecular formula C7H4F6OS and a molecular weight of 250.16 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-thiophen-2-ylpropan-2-ol. InChIKey: KGZKDTLMIOPAKW-UHFFFAOYSA-N.
| Molecular formula | C7H4F6OS |
|---|---|
| Molecular weight | 250.16 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-thiophen-2-ylpropan-2-ol |
| InChIKey | KGZKDTLMIOPAKW-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)