CAS 1240390-33-3 is the registry number for tert-Butyl ((3S,4S)-4-hydroxytetrahydro-2H-pyran-3-yl)carbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamate (CAS 1240390-33-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamate. InChIKey: FSSQTAOGGBWNKE-YUMQZZPRSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamate |
| InChIKey | FSSQTAOGGBWNKE-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COCC[C@@H]1O |
Computed by PubChem (NCBI)