CAS 1240470-84-1 appears in our catalog under these names: Ambrisentan Impurity 8, rac Ambrisentan Methyl Ester. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (CAS 1240470-84-1) is a chemical compound with the molecular formula C23H24N2O4 and a molecular weight of 392.4 g/mol. IUPAC name: methyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate. InChIKey: RCOLWOXJIUGEGI-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O4 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | methyl 2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| InChIKey | RCOLWOXJIUGEGI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)OC(C(=O)OC)C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)C |
Computed by PubChem (NCBI)