Products 1794817-24-5
CAS 1794817-24-5 is the registry number for O-Desmethyl Carvedilol-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
2-[2-[[3-(9H-carbazol-4-yloxy)-1,1,2,3,3-pentadeuterio-2-hydroxypropyl]amino]ethoxy]phenol (CAS 1794817-24-5) is a chemical compound with the molecular formula C23H24N2O4 and a molecular weight of 397.5 g/mol. IUPAC name: 2-[2-[[3-(9H-carbazol-4-yloxy)-1,1,2,3,3-pentadeuterio-2-hydroxypropyl]amino]ethoxy]phenol. InChIKey: XAUKPPPYYOKVQJ-SUTULTBBSA-N.
| Molecular formula | C23H24N2O4 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 2-[2-[[3-(9H-carbazol-4-yloxy)-1,1,2,3,3-pentadeuterio-2-hydroxypropyl]amino]ethoxy]phenol |
| InChIKey | XAUKPPPYYOKVQJ-SUTULTBBSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC2=C1C3=CC=CC=C3N2)O)NCCOC4=CC=CC=C4O |
Computed by PubChem (NCBI)