CAS 1240526-91-3 is the registry number for 6-Chloro-3-(piperidin-4-ylidene)-2,3-dihydro-1H-indol-2-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-3-piperidin-4-ylidene-1H-indol-2-one;hydrochloride (CAS 1240526-91-3) is a chemical compound with the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. IUPAC name: 6-chloro-3-piperidin-4-ylidene-1H-indol-2-one;hydrochloride. InChIKey: KXJAPYBPDRBULW-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2O |
|---|---|
| Molecular weight | 285.17 g/mol |
| IUPAC name | 6-chloro-3-piperidin-4-ylidene-1H-indol-2-one;hydrochloride |
| InChIKey | KXJAPYBPDRBULW-UHFFFAOYSA-N |
| SMILES | C1CNCCC1=C2C3=C(C=C(C=C3)Cl)NC2=O.Cl |
Computed by PubChem (NCBI)