CAS 1504791-19-8 is the registry number for 2-(2-Aminobutyl)-5,7-dichloroisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-aminobutyl)-5,7-dichloroisoquinolin-1-one (CAS 1504791-19-8) is a chemical compound with the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. IUPAC name: 2-(2-aminobutyl)-5,7-dichloroisoquinolin-1-one. InChIKey: NFHOYEOMUDHLHQ-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl2N2O |
|---|---|
| Molecular weight | 285.17 g/mol |
| IUPAC name | 2-(2-aminobutyl)-5,7-dichloroisoquinolin-1-one |
| InChIKey | NFHOYEOMUDHLHQ-UHFFFAOYSA-N |
| SMILES | CCC(CN1C=CC2=C(C1=O)C=C(C=C2Cl)Cl)N |
Computed by PubChem (NCBI)