CAS 1240527-54-1 appears in our catalog under these names: 2-(4-(Pyridin-4-yl)-1,3-thiazol-2-yl)ethan-1-amine dihydrochloride, 95%, 2-(4-(Pyridin-4-yl)-1,3-thiazol-2-yl)ethan-1-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride (CAS 1240527-54-1) is a chemical compound with the molecular formula C10H13Cl2N3S and a molecular weight of 278.20 g/mol. IUPAC name: 2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride. InChIKey: RTTUOCIRQJAMDO-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3S |
|---|---|
| Molecular weight | 278.20 g/mol |
| IUPAC name | 2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | RTTUOCIRQJAMDO-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CSC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)