CAS 1269152-59-1 appears in our catalog under these names: 1-(4-(Pyridin-3-yl)-1,3-thiazol-2-yl)ethan-1-amine dihydrochloride, 1-(4-(Pyridin-3-yl)-1,3-thiazol-2-yl)ethan-1-amine dihydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g, 1g.
1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride (CAS 1269152-59-1) is a chemical compound with the molecular formula C10H13Cl2N3S and a molecular weight of 278.20 g/mol. IUPAC name: 1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride. InChIKey: NHQVCSYLFXVRBG-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N3S |
|---|---|
| Molecular weight | 278.20 g/mol |
| IUPAC name | 1-(4-pyridin-3-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | NHQVCSYLFXVRBG-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CS1)C2=CN=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)