Products 1240528-31-7
CAS 1240528-31-7 appears in our catalog under these names: Methyl 3-sulfamoyl-5-(trifluoromethyl)benzoate, 95%, Methyl 3-sulfamoyl-5-(trifluoromethyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Methyl 3-sulfamoyl-5-(trifluoromethyl)benzoate (CAS 1240528-31-7) is a chemical compound with the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. IUPAC name: methyl 3-sulfamoyl-5-(trifluoromethyl)benzoate. InChIKey: QHAVGCPXJJMNDV-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO4S |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | methyl 3-sulfamoyl-5-(trifluoromethyl)benzoate |
| InChIKey | QHAVGCPXJJMNDV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)