CAS 496026-17-6 is the registry number for (2-Trifluoromethyl-benzenesulfonylamino)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[[2-(trifluoromethyl)phenyl]sulfonylamino]acetic acid (CAS 496026-17-6) is a chemical compound with the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. IUPAC name: 2-[[2-(trifluoromethyl)phenyl]sulfonylamino]acetic acid. InChIKey: HIBGRSZLZBKARM-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO4S |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 2-[[2-(trifluoromethyl)phenyl]sulfonylamino]acetic acid |
| InChIKey | HIBGRSZLZBKARM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)S(=O)(=O)NCC(=O)O |
Computed by PubChem (NCBI)