CAS 1240528-59-9 is the registry number for (1-(6-Chloropyrazin-2-yl)-1H-1,2,3-triazol-5-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[3-(6-chloropyrazin-2-yl)triazol-4-yl]methanol (CAS 1240528-59-9) is a chemical compound with the molecular formula C7H6ClN5O and a molecular weight of 211.61 g/mol. IUPAC name: [3-(6-chloropyrazin-2-yl)triazol-4-yl]methanol. InChIKey: BYUCGKZFNMJCFR-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN5O |
|---|---|
| Molecular weight | 211.61 g/mol |
| IUPAC name | [3-(6-chloropyrazin-2-yl)triazol-4-yl]methanol |
| InChIKey | BYUCGKZFNMJCFR-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=N1)C2=CN=CC(=N2)Cl)CO |
Computed by PubChem (NCBI)