Products 1240565-36-9
CAS 1240565-36-9 is the registry number for 1-([3-Chloro-4-(trifluoromethoxy)phenyl]methyl)piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]piperazine (CAS 1240565-36-9) is a chemical compound with the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. IUPAC name: 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]piperazine. InChIKey: CORFEAHPQZDQBT-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF3N2O |
|---|---|
| Molecular weight | 294.70 g/mol |
| IUPAC name | 1-[[3-chloro-4-(trifluoromethoxy)phenyl]methyl]piperazine |
| InChIKey | CORFEAHPQZDQBT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=C(C=C2)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)