CAS 2044834-79-7 appears in our catalog under these names: 1-{(4-(trifluoromethyl)phenyl)methyl}piperazin-2-one hydrochloride, 95%, 1-{(4-(Trifluoromethyl)phenyl)methyl}piperazin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-[[4-(trifluoromethyl)phenyl]methyl]piperazin-2-one;hydrochloride (CAS 2044834-79-7) is a chemical compound with the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. IUPAC name: 1-[[4-(trifluoromethyl)phenyl]methyl]piperazin-2-one;hydrochloride. InChIKey: OPZMBLZJKOQDTR-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF3N2O |
|---|---|
| Molecular weight | 294.70 g/mol |
| IUPAC name | 1-[[4-(trifluoromethyl)phenyl]methyl]piperazin-2-one;hydrochloride |
| InChIKey | OPZMBLZJKOQDTR-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)CC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)