CAS 1240572-59-1 is the registry number for 1-(1-Phenylethyl)-1H-pyrazol-4-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(1-phenylethyl)pyrazol-4-amine (CAS 1240572-59-1) is a chemical compound with the molecular formula C11H13N3 and a molecular weight of 187.24 g/mol. IUPAC name: 1-(1-phenylethyl)pyrazol-4-amine. InChIKey: JFGCAKGDLZOKNA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1-(1-phenylethyl)pyrazol-4-amine |
| InChIKey | JFGCAKGDLZOKNA-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C=C(C=N2)N |
Computed by PubChem (NCBI)