CAS 1240595-08-7 appears in our catalog under these names: 2-Bromo-6-(trifluoromethyl)quinoxaline, 95+%, 2-Bromo-6-(trifluoromethyl)quinoxaline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-bromo-6-(trifluoromethyl)quinoxaline (CAS 1240595-08-7) is a chemical compound with the molecular formula C9H4BrF3N2 and a molecular weight of 277.04 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)quinoxaline. InChIKey: KSURKDBUCANNAV-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3N2 |
|---|---|
| Molecular weight | 277.04 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)quinoxaline |
| InChIKey | KSURKDBUCANNAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN=C2C=C1C(F)(F)F)Br |
Computed by PubChem (NCBI)