CAS 1287218-49-8 appears in our catalog under these names: 5-Bromo-7-(trifluoromethyl)quinoxaline, 95%, 5-Bromo-7-(Trifluoromethyl)quinoxaline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
5-bromo-7-(trifluoromethyl)quinoxaline (CAS 1287218-49-8) is a chemical compound with the molecular formula C9H4BrF3N2 and a molecular weight of 277.04 g/mol. IUPAC name: 5-bromo-7-(trifluoromethyl)quinoxaline. InChIKey: ZFNGPPUUBRENPS-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3N2 |
|---|---|
| Molecular weight | 277.04 g/mol |
| IUPAC name | 5-bromo-7-(trifluoromethyl)quinoxaline |
| InChIKey | ZFNGPPUUBRENPS-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=CC(=CC2=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)