Products 1240599-08-9
CAS 1240599-08-9 appears in our catalog under these names: 2-Chloro-6-(trifluoromethyl)pyrimidin-4-ol 95%, 2-Chloro-6-(trifluoromethyl)pyrimidin-4-ol, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-4-(trifluoromethyl)-1H-pyrimidin-6-one (CAS 1240599-08-9) is a chemical compound with the molecular formula C5H2ClF3N2O and a molecular weight of 198.53 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)-1H-pyrimidin-6-one. InChIKey: DVCJEUZBCZMOCJ-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF3N2O |
|---|---|
| Molecular weight | 198.53 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| InChIKey | DVCJEUZBCZMOCJ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(NC1=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)