CAS 1803596-66-8 is the registry number for 2-chloro-5-(trifluoromethoxy)pyrazine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
2-chloro-5-(trifluoromethoxy)pyrazine (CAS 1803596-66-8) is a chemical compound with the molecular formula C5H2ClF3N2O and a molecular weight of 198.53 g/mol. IUPAC name: 2-chloro-5-(trifluoromethoxy)pyrazine. InChIKey: ICXFWEHIUZEZEK-UHFFFAOYSA-N.
| Molecular formula | C5H2ClF3N2O |
|---|---|
| Molecular weight | 198.53 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethoxy)pyrazine |
| InChIKey | ICXFWEHIUZEZEK-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)