Products 1240600-83-2

CAS 1240600-83-2 is the registry number for tert-Butyl N-((5-aminopyrimidin-2-yl)methyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(5-aminopyrimidin-2-yl)methyl]carbamate (CAS 1240600-83-2) is a chemical compound with the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. IUPAC name: tert-butyl N-[(5-aminopyrimidin-2-yl)methyl]carbamate. InChIKey: JEKVFXVVRNFBFA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16N4O2
Molecular weight224.26 g/mol
IUPAC nametert-butyl N-[(5-aminopyrimidin-2-yl)methyl]carbamate
InChIKeyJEKVFXVVRNFBFA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1=NC=C(C=N1)N

Computed by PubChem (NCBI)