Products 1241045-79-3
CAS 1241045-79-3 appears in our catalog under these names: 4-Acetamidocyclohexanol-d10, 4–Acetamidocyclohexanol–d10, N-(4-hydroxycyclohexyl)acetamide-d10. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 100mg, 10 mg, 25 mg.
N-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-hydroxycyclohexyl)acetamide (CAS 1241045-79-3) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 167.27 g/mol. IUPAC name: N-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-hydroxycyclohexyl)acetamide. InChIKey: HWAFCRWGGRVEQL-XDCJMDAHSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 167.27 g/mol |
| IUPAC name | N-(1,2,2,3,3,4,5,5,6,6-decadeuterio-4-hydroxycyclohexyl)acetamide |
| InChIKey | HWAFCRWGGRVEQL-XDCJMDAHSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])NC(=O)C)([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)