CAS 1241377-74-1 appears in our catalog under these names: 6–Bromo–1,2–naphthalenediamine, 6-Bromonaphthalene-1,2-diamine, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 50mg.
6-bromonaphthalene-1,2-diamine (CAS 1241377-74-1) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 6-bromonaphthalene-1,2-diamine. InChIKey: XTONHEFSOWWNHK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 6-bromonaphthalene-1,2-diamine |
| InChIKey | XTONHEFSOWWNHK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N)N)C=C1Br |
Computed by PubChem (NCBI)