Products 1241379-64-5
CAS 1241379-64-5 is the registry number for 1-(1,1-Dimethylethyl) (2S)-2-[[(4-carboxyphenyl)amino]carbonyl]-1-pyrrolidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]benzoic acid (CAS 1241379-64-5) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: 4-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]benzoic acid. InChIKey: VYLJNTCTXSDNGT-ZDUSSCGKSA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 4-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]benzoic acid |
| InChIKey | VYLJNTCTXSDNGT-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)