Products 1241391-14-9
CAS 1241391-14-9 appears in our catalog under these names: MC-GGFG-AM-(10Me-11F-Camptothecin) intermediate-1, 97.47%, MC-GGFG-AM-(10Me-11F-Camptothecin) intermediate-1, 95%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 500 mg, 10 g, 1 g, 100 mg, 5 g, 250 mg, 250mg, 1g.
1-(2-amino-4-fluoro-5-methylphenyl)-2-chloroethanone (CAS 1241391-14-9) is a chemical compound with the molecular formula C9H9ClFNO and a molecular weight of 201.62 g/mol. IUPAC name: 1-(2-amino-4-fluoro-5-methylphenyl)-2-chloroethanone. InChIKey: CFKRLPYICZQJME-UHFFFAOYSA-N.
| Molecular formula | C9H9ClFNO |
|---|---|
| Molecular weight | 201.62 g/mol |
| IUPAC name | 1-(2-amino-4-fluoro-5-methylphenyl)-2-chloroethanone |
| InChIKey | CFKRLPYICZQJME-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)N)C(=O)CCl |
Computed by PubChem (NCBI)