Products 1241677-52-0

CAS 1241677-52-0 is the registry number for Ethyl 2-amino-3-(2-bromophenyl)-2-methylpropanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-3-(2-bromophenyl)-2-methylpropanoate;hydrochloride (CAS 1241677-52-0) is a chemical compound with the molecular formula C12H17BrClNO2 and a molecular weight of 322.62 g/mol. IUPAC name: ethyl 2-amino-3-(2-bromophenyl)-2-methylpropanoate;hydrochloride. InChIKey: RNXUAGRVXWQERN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17BrClNO2
Molecular weight322.62 g/mol
IUPAC nameethyl 2-amino-3-(2-bromophenyl)-2-methylpropanoate;hydrochloride
InChIKeyRNXUAGRVXWQERN-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(CC1=CC=CC=C1Br)N.Cl

Computed by PubChem (NCBI)