CAS 502842-45-7 appears in our catalog under these names: Ethyl 3-amino-3-(4-bromo-2-methylphenyl)propanoate hydrochloride, 97%, Ethyl 3-amino-3-(4-bromo-2-methylphenyl)propanoate, HCl, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Ethyl 3-amino-3-(4-bromo-2-methylphenyl)propanoate;hydrochloride (CAS 502842-45-7) is a chemical compound with the molecular formula C12H17BrClNO2 and a molecular weight of 322.62 g/mol. IUPAC name: ethyl 3-amino-3-(4-bromo-2-methylphenyl)propanoate;hydrochloride. InChIKey: KDODGCNUQXKFJU-UHFFFAOYSA-N.
| Molecular formula | C12H17BrClNO2 |
|---|---|
| Molecular weight | 322.62 g/mol |
| IUPAC name | ethyl 3-amino-3-(4-bromo-2-methylphenyl)propanoate;hydrochloride |
| InChIKey | KDODGCNUQXKFJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=C(C=C(C=C1)Br)C)N.Cl |
Computed by PubChem (NCBI)