CAS 1241678-35-2 appears in our catalog under these names: 3-(Trifluoromethoxy)-L-phenylalanine, 95%, H-L-Phe(3-OCF3)-OH. Offered by: AmBeed, Iris Biotech. Available pack sizes: 1g, 50mg, 250mg.
(2S)-2-amino-3-[3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1241678-35-2) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: (2S)-2-amino-3-[3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: NIONQVYUGGCUHI-QMMMGPOBSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | NIONQVYUGGCUHI-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)