Products 439587-14-1

CAS 439587-14-1 is the registry number for 2-Amino-3-(3-(trifluoromethoxy)phenyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-amino-3-[3-(trifluoromethoxy)phenyl]propanoic acid (CAS 439587-14-1) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: 2-amino-3-[3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: NIONQVYUGGCUHI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10F3NO3
Molecular weight249.19 g/mol
IUPAC name2-amino-3-[3-(trifluoromethoxy)phenyl]propanoic acid
InChIKeyNIONQVYUGGCUHI-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)OC(F)(F)F)CC(C(=O)O)N

Computed by PubChem (NCBI)