Products 1241680-70-5
CAS 1241680-70-5 is the registry number for (S)-2-(3-Chloro-4,5-difluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3-chloro-4,5-difluorophenyl)pyrrolidine (CAS 1241680-70-5) is a chemical compound with the molecular formula C10H10ClF2N and a molecular weight of 217.64 g/mol. IUPAC name: (2S)-2-(3-chloro-4,5-difluorophenyl)pyrrolidine. InChIKey: KWORTINNVLSBOK-VIFPVBQESA-N.
| Molecular formula | C10H10ClF2N |
|---|---|
| Molecular weight | 217.64 g/mol |
| IUPAC name | (2S)-2-(3-chloro-4,5-difluorophenyl)pyrrolidine |
| InChIKey | KWORTINNVLSBOK-VIFPVBQESA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C(=C2)Cl)F)F |
Computed by PubChem (NCBI)