CAS 1241680-98-7 is the registry number for H-L-Phe(3,5-(CF3)2)-OH. Offered by: Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid (CAS 1241680-98-7) is a chemical compound with the molecular formula C11H9F6NO2 and a molecular weight of 301.18 g/mol. IUPAC name: (2S)-2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid. InChIKey: NMTMNIDBMOGRKI-QMMMGPOBSA-N.
| Molecular formula | C11H9F6NO2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | (2S)-2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | NMTMNIDBMOGRKI-QMMMGPOBSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)