CAS 237076-69-6 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)-D,L-phenylalanine, 95%, 2-Amino-3-(3,5-bis(trifluoromethyl)phenyl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid (CAS 237076-69-6) is a chemical compound with the molecular formula C11H9F6NO2 and a molecular weight of 301.18 g/mol. IUPAC name: 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid. InChIKey: NMTMNIDBMOGRKI-UHFFFAOYSA-N.
| Molecular formula | C11H9F6NO2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 2-amino-3-[3,5-bis(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | NMTMNIDBMOGRKI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)