CAS 1241682-49-4 appears in our catalog under these names: (S)–1–(3–Fluoro–4–methylphenyl)ethanamine, (1S)-1-(3-Fluoro-4-methylphenyl)ethylamine, 95%, (1S)-1-(3-FLUORO-4-METHYLPHENYL)ETHYLAMINE, 97%, (S)-1-(3-Fluoro-4-methylphenyl)ethanamine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(3-fluoro-4-methylphenyl)ethanamine (CAS 1241682-49-4) is a chemical compound with the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. IUPAC name: (1S)-1-(3-fluoro-4-methylphenyl)ethanamine. InChIKey: LTXLBDDARARPQF-ZETCQYMHSA-N.
| Molecular formula | C9H12FN |
|---|---|
| Molecular weight | 153.20 g/mol |
| IUPAC name | (1S)-1-(3-fluoro-4-methylphenyl)ethanamine |
| InChIKey | LTXLBDDARARPQF-ZETCQYMHSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@H](C)N)F |
Computed by PubChem (NCBI)