CAS 473732-86-4 appears in our catalog under these names: (S)–1–(4–Fluorophenyl)propan–1–amine, (1S)-1-(4-Fluorophenyl)propan-1-amine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(4-fluorophenyl)propan-1-amine (CAS 473732-86-4) is a chemical compound with the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. IUPAC name: (1S)-1-(4-fluorophenyl)propan-1-amine. InChIKey: BWZFVQWUKNCKQL-VIFPVBQESA-N.
| Molecular formula | C9H12FN |
|---|---|
| Molecular weight | 153.20 g/mol |
| IUPAC name | (1S)-1-(4-fluorophenyl)propan-1-amine |
| InChIKey | BWZFVQWUKNCKQL-VIFPVBQESA-N |
| SMILES | CC[C@@H](C1=CC=C(C=C1)F)N |
Computed by PubChem (NCBI)