CAS 1241683-08-8 appears in our catalog under these names: (S)-1-(2,4,6-Trifluorophenyl)ethan-1-amine 95%, (1S)-1-(2,4,6-trifluorophenyl)ethan-1-amine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(1S)-1-(2,4,6-trifluorophenyl)ethanamine (CAS 1241683-08-8) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: (1S)-1-(2,4,6-trifluorophenyl)ethanamine. InChIKey: SHTDOEJRDZKMMX-BYPYZUCNSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | (1S)-1-(2,4,6-trifluorophenyl)ethanamine |
| InChIKey | SHTDOEJRDZKMMX-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1F)F)F)N |
Computed by PubChem (NCBI)