CAS 1241800-35-0 appears in our catalog under these names: 3-[5-(2-Carboxyethyl) pyrazon-2-yl] propionic acid, 95%, 3-(5-(2-Carboxyethyl) pyrazon-2-yl) propionic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2g.
3-[5-(carboxymethyl)-3-oxo-1H-pyrazol-2-yl]propanoic acid (CAS 1241800-35-0) is a chemical compound with the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. IUPAC name: 3-[5-(carboxymethyl)-3-oxo-1H-pyrazol-2-yl]propanoic acid. InChIKey: VACNUCIWVNKGQT-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O5 |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 3-[5-(carboxymethyl)-3-oxo-1H-pyrazol-2-yl]propanoic acid |
| InChIKey | VACNUCIWVNKGQT-UHFFFAOYSA-N |
| SMILES | C1=C(NN(C1=O)CCC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)