Products 318468-73-4

CAS 318468-73-4 is the registry number for 5-Amino-1-methylpyridin-2(1H)-one oxalate, 98+%. Offered by: AmBeed. Available pack sizes: 25g, 1g.

Structural formula: {0} (CAS {1})

5-amino-1-methylpyridin-2-one;oxalic acid (CAS 318468-73-4) is a chemical compound with the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. IUPAC name: 5-amino-1-methylpyridin-2-one;oxalic acid. InChIKey: BBBSPXBKMZHOHR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O5
Molecular weight214.18 g/mol
IUPAC name5-amino-1-methylpyridin-2-one;oxalic acid
InChIKeyBBBSPXBKMZHOHR-UHFFFAOYSA-N
SMILESCN1C=C(C=CC1=O)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)