Products 1242-67-7
CAS 1242-67-7 appears in our catalog under these names: Cannabidiol dimethyl ether, Cannabidiol dimethyl ether. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 25mg, 100mg.
1,3-dimethoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene (CAS 1242-67-7) is a chemical compound with the molecular formula C23H34O2 and a molecular weight of 342.5 g/mol. IUPAC name: 1,3-dimethoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene. InChIKey: UYBGHBAVRNATET-VQTJNVASSA-N.
| Molecular formula | C23H34O2 |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 1,3-dimethoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene |
| InChIKey | UYBGHBAVRNATET-VQTJNVASSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)OC)[C@@H]2C=C(CC[C@H]2C(=C)C)C)OC |
Computed by PubChem (NCBI)